C18H25BrN2O4 — CID 70986127
tert-butyl N-[2-[[2-(4-bromophenyl)-2-oxoethyl]amino]-2-oxoethyl]-N-propylcarbamate (PubChem CID 70986127) has the molecular formula C18H25BrN2O4 and a molecular weight of 413.31 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(4-bromophenyl)-2-oxoethyl]amino]-2-oxoethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[[2-(4-bromophenyl)-2-oxoethyl]amino]-2-oxoethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 70986127 |
| Molecular Formula | C18H25BrN2O4 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | tert-butyl N-[2-[[2-(4-bromophenyl)-2-oxoethyl]amino]-2-oxoethyl]-N-propylcarbamate |
| SMILES | CCCN(CC(=O)NCC(=O)c1ccc(Br)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25BrN2O4/c1-5-10-21(17(24)25-18(2,3)4)12-16(23)20-11-15(22)13-6-8-14(19)9-7-13/h6-9H,5,10-12H2,1-4H3,(H,20,23) |
| InChIKey | NDRVJAMPYQKVLI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |