C21H21F3N2O5 — CID 69314716
3-[4-[[3-acetamido-5-(trifluoromethyl)phenyl]methoxy]-3,5-dimethylanilino]-3-oxopropanoic acid (PubChem CID 69314716) has the molecular formula C21H21F3N2O5 and a molecular weight of 438.40 g/mol. Its IUPAC name is 3-[4-[[3-acetamido-5-(trifluoromethyl)phenyl]methoxy]-3,5-dimethylanilino]-3-oxopropanoic acid.
| Compound Name | 3-[4-[[3-acetamido-5-(trifluoromethyl)phenyl]methoxy]-3,5-dimethylanilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 69314716 |
| Molecular Formula | C21H21F3N2O5 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 3-[4-[[3-acetamido-5-(trifluoromethyl)phenyl]methoxy]-3,5-dimethylanilino]-3-oxopropanoic acid |
| SMILES | CC(=O)Nc1cc(COc2c(C)cc(NC(=O)CC(=O)O)cc2C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H21F3N2O5/c1-11-4-16(26-18(28)9-19(29)30)5-12(2)20(11)31-10-14-6-15(21(22,23)24)8-17(7-14)25-13(3)27/h4-8H,9-10H2,1-3H3,(H,25,27)(H,26,28)(H,29,30) |
| InChIKey | IUMFJEVXHVILAY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|