C23H25F3N2O4 — CID 69244667
3-[4-[[3-(cyclobutylamino)-5-(trifluoromethyl)phenyl]methoxy]-3,5-dimethylanilino]-3-oxopropanoic acid (PubChem CID 69244667) has the molecular formula C23H25F3N2O4 and a molecular weight of 450.46 g/mol. Its IUPAC name is 3-[4-[[3-(cyclobutylamino)-5-(trifluoromethyl)phenyl]methoxy]-3,5-dimethylanilino]-3-oxopropanoic acid.
| Compound Name | 3-[4-[[3-(cyclobutylamino)-5-(trifluoromethyl)phenyl]methoxy]-3,5-dimethylanilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 69244667 |
| Molecular Formula | C23H25F3N2O4 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3-[4-[[3-(cyclobutylamino)-5-(trifluoromethyl)phenyl]methoxy]-3,5-dimethylanilino]-3-oxopropanoic acid |
| SMILES | Cc1cc(NC(=O)CC(=O)O)cc(C)c1OCc1cc(NC2CCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H25F3N2O4/c1-13-6-18(28-20(29)11-21(30)31)7-14(2)22(13)32-12-15-8-16(23(24,25)26)10-19(9-15)27-17-4-3-5-17/h6-10,17,27H,3-5,11-12H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | PXRRMLDKVDSEIY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|