C13H15F6N3S — CID 22302786
1-[3,5-bis(trifluoromethyl)phenyl]-1-(tert-butylamino)thiourea (PubChem CID 22302786) has the molecular formula C13H15F6N3S and a molecular weight of 359.34 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-1-(tert-butylamino)thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-1-(tert-butylamino)thiourea |
|---|---|
| PubChem CID | 22302786 |
| Molecular Formula | C13H15F6N3S |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-1-(tert-butylamino)thiourea |
| SMILES | CC(C)(C)NN(C(N)=S)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F6N3S/c1-11(2,3)21-22(10(20)23)9-5-7(12(14,15)16)4-8(6-9)13(17,18)19/h4-6,21H,1-3H3,(H2,20,23) |
| InChIKey | YMADRQNQVTUDQF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|