C14H6Cl4F6N4S — CID 22308104
1-[3,5-bis(trifluoromethyl)phenyl]-1-[(2,3,5,6-tetrachloro-4-pyridinyl)amino]thiourea (PubChem CID 22308104) has the molecular formula C14H6Cl4F6N4S and a molecular weight of 518.10 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-1-[(2,3,5,6-tetrachloro-4-pyridinyl)amino]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-1-[(2,3,5,6-tetrachloro-4-pyridinyl)amino]thiourea |
|---|---|
| PubChem CID | 22308104 |
| Molecular Formula | C14H6Cl4F6N4S |
| Molecular Weight | 518.10 g/mol |
| Exact Mass | 515.90 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-1-[(2,3,5,6-tetrachloro-4-pyridinyl)amino]thiourea |
| SMILES | NC(=S)N(Nc1c(Cl)c(Cl)nc(Cl)c1Cl)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H6Cl4F6N4S/c15-7-9(8(16)11(18)26-10(7)17)27-28(12(25)29)6-2-4(13(19,20)21)1-5(3-6)14(22,23)24/h1-3H,(H2,25,29)(H,26,27) |
| InChIKey | DLYCVHOERMMZEW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.10 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|