C15H20BrF3N2O — CID 175940649
2-bromo-N'-tert-butyl-N-[2,6-dimethyl-4-(trifluoromethyl)phenyl]acetohydrazide (PubChem CID 175940649) has the molecular formula C15H20BrF3N2O and a molecular weight of 381.24 g/mol. Its IUPAC name is 2-bromo-N'-tert-butyl-N-[2,6-dimethyl-4-(trifluoromethyl)phenyl]acetohydrazide.
| Compound Name | 2-bromo-N'-tert-butyl-N-[2,6-dimethyl-4-(trifluoromethyl)phenyl]acetohydrazide |
|---|---|
| PubChem CID | 175940649 |
| Molecular Formula | C15H20BrF3N2O |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-bromo-N'-tert-butyl-N-[2,6-dimethyl-4-(trifluoromethyl)phenyl]acetohydrazide |
| SMILES | Cc1cc(C(F)(F)F)cc(C)c1N(NC(C)(C)C)C(=O)CBr |
| InChI | InChI=1S/C15H20BrF3N2O/c1-9-6-11(15(17,18)19)7-10(2)13(9)21(12(22)8-16)20-14(3,4)5/h6-7,20H,8H2,1-5H3 |
| InChIKey | PPJBFXWLGIZICI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|