C10H6BrF6NO — CID 22708279
N-[2,4-bis(trifluoromethyl)phenyl]-2-bromoacetamide (PubChem CID 22708279) has the molecular formula C10H6BrF6NO and a molecular weight of 350.06 g/mol. Its IUPAC name is N-[2,4-bis(trifluoromethyl)phenyl]-2-bromoacetamide.
| Compound Name | N-[2,4-bis(trifluoromethyl)phenyl]-2-bromoacetamide |
|---|---|
| PubChem CID | 22708279 |
| Molecular Formula | C10H6BrF6NO |
| Molecular Weight | 350.06 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | N-[2,4-bis(trifluoromethyl)phenyl]-2-bromoacetamide |
| SMILES | O=C(CBr)Nc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H6BrF6NO/c11-4-8(19)18-7-2-1-5(9(12,13)14)3-6(7)10(15,16)17/h1-3H,4H2,(H,18,19) |
| InChIKey | IHAXRGNVDIEZCM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.06 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|