C9H11NO3 — CID 90280420
2-(3,5-dihydroxyphenyl)-N-methylacetamide (PubChem CID 90280420) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-(3,5-dihydroxyphenyl)-N-methylacetamide.
| Compound Name | 2-(3,5-dihydroxyphenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 90280420 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-(3,5-dihydroxyphenyl)-N-methylacetamide |
| SMILES | CNC(=O)Cc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C9H11NO3/c1-10-9(13)4-6-2-7(11)5-8(12)3-6/h2-3,5,11-12H,4H2,1H3,(H,10,13) |
| InChIKey | NOVZHIYRLBPWOF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |