C13H14F3NO5S — CID 59010933
diethyl 2-[[4-(trifluoromethyl)thiophene-3-carbonyl]amino]propanedioate (PubChem CID 59010933) has the molecular formula C13H14F3NO5S and a molecular weight of 353.32 g/mol. Its IUPAC name is diethyl 2-[[4-(trifluoromethyl)thiophene-3-carbonyl]amino]propanedioate.
| Compound Name | diethyl 2-[[4-(trifluoromethyl)thiophene-3-carbonyl]amino]propanedioate |
|---|---|
| PubChem CID | 59010933 |
| Molecular Formula | C13H14F3NO5S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | diethyl 2-[[4-(trifluoromethyl)thiophene-3-carbonyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1cscc1C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C13H14F3NO5S/c1-3-21-11(19)9(12(20)22-4-2)17-10(18)7-5-23-6-8(7)13(14,15)16/h5-6,9H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | NINHAQPAPRLMAH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|