C9H6F3NO5S — CID 69475877
2-[[4-(trifluoromethyl)thiophene-3-carbonyl]amino]propanedioic acid (PubChem CID 69475877) has the molecular formula C9H6F3NO5S and a molecular weight of 297.21 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)thiophene-3-carbonyl]amino]propanedioic acid.
| Compound Name | 2-[[4-(trifluoromethyl)thiophene-3-carbonyl]amino]propanedioic acid |
|---|---|
| PubChem CID | 69475877 |
| Molecular Formula | C9H6F3NO5S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 2-[[4-(trifluoromethyl)thiophene-3-carbonyl]amino]propanedioic acid |
| SMILES | O=C(NC(C(=O)O)C(=O)O)c1cscc1C(F)(F)F |
| InChI | InChI=1S/C9H6F3NO5S/c10-9(11,12)4-2-19-1-3(4)6(14)13-5(7(15)16)8(17)18/h1-2,5H,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | KWFBJWOKOJZATQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|