C11H9F3NO5S- — CID 148920420
3-ethoxy-3-oxo-2-[[4-(trifluoromethyl)thiophene-3-carbonyl]amino]propanoate (PubChem CID 148920420) has the molecular formula C11H9F3NO5S- and a molecular weight of 324.26 g/mol. Its IUPAC name is 3-ethoxy-3-oxo-2-[[4-(trifluoromethyl)thiophene-3-carbonyl]amino]propanoate.
| Compound Name | 3-ethoxy-3-oxo-2-[[4-(trifluoromethyl)thiophene-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 148920420 |
| Molecular Formula | C11H9F3NO5S- |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 3-ethoxy-3-oxo-2-[[4-(trifluoromethyl)thiophene-3-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)C(NC(=O)c1cscc1C(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C11H10F3NO5S/c1-2-20-10(19)7(9(17)18)15-8(16)5-3-21-4-6(5)11(12,13)14/h3-4,7H,2H2,1H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | NPBAFWAVFGSMDO-UHFFFAOYSA-M |
| XLogP | 0.18 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|