C12H14INO5S — CID 78948965
diethyl 2-[(5-iodothiophene-3-carbonyl)amino]propanedioate (PubChem CID 78948965) has the molecular formula C12H14INO5S and a molecular weight of 411.22 g/mol. Its IUPAC name is diethyl 2-[(5-iodothiophene-3-carbonyl)amino]propanedioate.
| Compound Name | diethyl 2-[(5-iodothiophene-3-carbonyl)amino]propanedioate |
|---|---|
| PubChem CID | 78948965 |
| Molecular Formula | C12H14INO5S |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | diethyl 2-[(5-iodothiophene-3-carbonyl)amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1csc(I)c1)C(=O)OCC |
| InChI | InChI=1S/C12H14INO5S/c1-3-18-11(16)9(12(17)19-4-2)14-10(15)7-5-8(13)20-6-7/h5-6,9H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | ISQSHEZMMUDUGI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|