C18H25NO5 — CID 42161531
2-methylprop-2-enyl (2S)-2-[(3,5-dimethoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 42161531) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-methylprop-2-enyl (2S)-2-[(3,5-dimethoxybenzoyl)amino]-3-methylbutanoate.
| Compound Name | 2-methylprop-2-enyl (2S)-2-[(3,5-dimethoxybenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 42161531 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-methylprop-2-enyl (2S)-2-[(3,5-dimethoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | C=C(C)COC(=O)[C@@H](NC(=O)c1cc(OC)cc(OC)c1)C(C)C |
| InChI | InChI=1S/C18H25NO5/c1-11(2)10-24-18(21)16(12(3)4)19-17(20)13-7-14(22-5)9-15(8-13)23-6/h7-9,12,16H,1,10H2,2-6H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | OWMWJMFHIJPDQP-INIZCTEOSA-N |
| XLogP | 2.58 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|