C13H16N4O8 — CID 101117262
N-[(2S,3R)-1-(ethoxyamino)-3-hydroxy-1-oxobutan-2-yl]-3,5-dinitrobenzamide (PubChem CID 101117262) has the molecular formula C13H16N4O8 and a molecular weight of 356.29 g/mol. Its IUPAC name is N-[(2S,3R)-1-(ethoxyamino)-3-hydroxy-1-oxobutan-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[(2S,3R)-1-(ethoxyamino)-3-hydroxy-1-oxobutan-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 101117262 |
| Molecular Formula | C13H16N4O8 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[(2S,3R)-1-(ethoxyamino)-3-hydroxy-1-oxobutan-2-yl]-3,5-dinitrobenzamide |
| SMILES | CCONC(=O)[C@@H](NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)[C@@H](C)O |
| InChI | InChI=1S/C13H16N4O8/c1-3-25-15-13(20)11(7(2)18)14-12(19)8-4-9(16(21)22)6-10(5-8)17(23)24/h4-7,11,18H,3H2,1-2H3,(H,14,19)(H,15,20)/t7-,11+/m1/s1 |
| InChIKey | ZIHPDGUMPZNKOM-HQJQHLMTSA-N |
| XLogP | 0.05 |
| TPSA | 173.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|