C32H34BrN2O3P — CID 164677594
N-[(2S)-1-(benzyl-bromo-diphenyl-λ5-phosphanyl)-3,3-dimethylbutan-2-yl]-4-nitrobenzamide (PubChem CID 164677594) has the molecular formula C32H34BrN2O3P and a molecular weight of 605.51 g/mol. Its IUPAC name is N-[(2S)-1-(benzyl-bromo-diphenyl-λ5-phosphanyl)-3,3-dimethylbutan-2-yl]-4-nitrobenzamide.
| Compound Name | N-[(2S)-1-(benzyl-bromo-diphenyl-λ5-phosphanyl)-3,3-dimethylbutan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 164677594 |
| Molecular Formula | C32H34BrN2O3P |
| Molecular Weight | 605.51 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | N-[(2S)-1-(benzyl-bromo-diphenyl-λ5-phosphanyl)-3,3-dimethylbutan-2-yl]-4-nitrobenzamide |
| SMILES | CC(C)(C)[C@@H](CP(Br)(Cc1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H34BrN2O3P/c1-32(2,3)30(34-31(36)26-19-21-27(22-20-26)35(37)38)24-39(33,28-15-9-5-10-16-28,29-17-11-6-12-18-29)23-25-13-7-4-8-14-25/h4-22,30H,23-24H2,1-3H3,(H,34,36)/t30-/m1/s1 |
| InChIKey | NNZMGFDCAZURDT-SSEXGKCCSA-N |
| XLogP | 7.45 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.51 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|