C20H17F6N3O3 — CID 60590912
[3,5-bis(trifluoromethyl)phenyl]-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 60590912) has the molecular formula C20H17F6N3O3 and a molecular weight of 461.36 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 60590912 |
| Molecular Formula | C20H17F6N3O3 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCN(Cc2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C20H17F6N3O3/c21-19(22,23)15-9-14(10-16(11-15)20(24,25)26)18(30)28-6-4-27(5-7-28)12-13-2-1-3-17(8-13)29(31)32/h1-3,8-11H,4-7,12H2 |
| InChIKey | CVKVNQLFSYLRKW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|