C25H22F3N3O3 — CID 175211845
(2-nitro-5-phenylphenyl)-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone (PubChem CID 175211845) has the molecular formula C25H22F3N3O3 and a molecular weight of 469.46 g/mol. Its IUPAC name is (2-nitro-5-phenylphenyl)-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone.
| Compound Name | (2-nitro-5-phenylphenyl)-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 175211845 |
| Molecular Formula | C25H22F3N3O3 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (2-nitro-5-phenylphenyl)-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(-c2ccccc2)ccc1[N+](=O)[O-])N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C25H22F3N3O3/c26-25(27,28)21-8-4-5-18(15-21)17-29-11-13-30(14-12-29)24(32)22-16-20(9-10-23(22)31(33)34)19-6-2-1-3-7-19/h1-10,15-16H,11-14,17H2 |
| InChIKey | UXNDQPFTNCKFBP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|