C18H20F3N5O3 — CID 19527436
2-(5-methyl-4-nitropyrazol-1-yl)-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethanone (PubChem CID 19527436) has the molecular formula C18H20F3N5O3 and a molecular weight of 411.38 g/mol. Its IUPAC name is 2-(5-methyl-4-nitropyrazol-1-yl)-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(5-methyl-4-nitropyrazol-1-yl)-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 19527436 |
| Molecular Formula | C18H20F3N5O3 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-(5-methyl-4-nitropyrazol-1-yl)-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethanone |
| SMILES | Cc1c([N+](=O)[O-])cnn1CC(=O)N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H20F3N5O3/c1-13-16(26(28)29)10-22-25(13)12-17(27)24-7-5-23(6-8-24)11-14-3-2-4-15(9-14)18(19,20)21/h2-4,9-10H,5-8,11-12H2,1H3 |
| InChIKey | FSVZLGFDEUMZJM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|