C19H13F6N3O3S — CID 5161843
[3,5-bis(trifluoromethyl)phenyl]-[2-[(3-nitrophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]methanone (PubChem CID 5161843) has the molecular formula C19H13F6N3O3S and a molecular weight of 477.39 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[2-[(3-nitrophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[2-[(3-nitrophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]methanone |
|---|---|
| PubChem CID | 5161843 |
| Molecular Formula | C19H13F6N3O3S |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[2-[(3-nitrophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCN=C1SCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H13F6N3O3S/c20-18(21,22)13-7-12(8-14(9-13)19(23,24)25)16(29)27-5-4-26-17(27)32-10-11-2-1-3-15(6-11)28(30)31/h1-3,6-9H,4-5,10H2 |
| InChIKey | BUDGXJMVDKIJFM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|