C17H13Cl2N3O3S — CID 4186222
(2,5-dichlorophenyl)-[2-[(3-nitrophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]methanone (PubChem CID 4186222) has the molecular formula C17H13Cl2N3O3S and a molecular weight of 410.28 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-[2-[(3-nitrophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]methanone.
| Compound Name | (2,5-dichlorophenyl)-[2-[(3-nitrophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]methanone |
|---|---|
| PubChem CID | 4186222 |
| Molecular Formula | C17H13Cl2N3O3S |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | (2,5-dichlorophenyl)-[2-[(3-nitrophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)ccc1Cl)N1CCN=C1SCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13Cl2N3O3S/c18-12-4-5-15(19)14(9-12)16(23)21-7-6-20-17(21)26-10-11-2-1-3-13(8-11)22(24)25/h1-5,8-9H,6-7,10H2 |
| InChIKey | OGOPWTDXBPDEQL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|