C18H15Cl2N3O4S — CID 4181103
2-(2,4-dichlorophenoxy)-1-[2-[(4-nitrophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]ethanone (PubChem CID 4181103) has the molecular formula C18H15Cl2N3O4S and a molecular weight of 440.31 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-[2-[(4-nitrophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-[2-[(4-nitrophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 4181103 |
| Molecular Formula | C18H15Cl2N3O4S |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-[2-[(4-nitrophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N1CCN=C1SCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15Cl2N3O4S/c19-13-3-6-16(15(20)9-13)27-10-17(24)22-8-7-21-18(22)28-11-12-1-4-14(5-2-12)23(25)26/h1-6,9H,7-8,10-11H2 |
| InChIKey | IHAXYEYHIAWTKT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|