C17H13ClFN3O3S — CID 4123699
(2-chloro-5-nitrophenyl)-[2-[(2-fluorophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]methanone (PubChem CID 4123699) has the molecular formula C17H13ClFN3O3S and a molecular weight of 393.83 g/mol. Its IUPAC name is (2-chloro-5-nitrophenyl)-[2-[(2-fluorophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]methanone.
| Compound Name | (2-chloro-5-nitrophenyl)-[2-[(2-fluorophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]methanone |
|---|---|
| PubChem CID | 4123699 |
| Molecular Formula | C17H13ClFN3O3S |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | (2-chloro-5-nitrophenyl)-[2-[(2-fluorophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1Cl)N1CCN=C1SCc1ccccc1F |
| InChI | InChI=1S/C17H13ClFN3O3S/c18-14-6-5-12(22(24)25)9-13(14)16(23)21-8-7-20-17(21)26-10-11-3-1-2-4-15(11)19/h1-6,9H,7-8,10H2 |
| InChIKey | LXEIKIGBCGJVTO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|