C20H20FN3O7 — CID 17366487
(3-fluorophenyl)-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]methanone;oxalic acid (PubChem CID 17366487) has the molecular formula C20H20FN3O7 and a molecular weight of 433.39 g/mol. Its IUPAC name is (3-fluorophenyl)-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]methanone;oxalic acid.
| Compound Name | (3-fluorophenyl)-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 17366487 |
| Molecular Formula | C20H20FN3O7 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (3-fluorophenyl)-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]methanone;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(c1cccc(F)c1)N1CCN(Cc2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H18FN3O3.C2H2O4/c19-16-5-2-4-15(12-16)18(23)21-9-7-20(8-10-21)13-14-3-1-6-17(11-14)22(24)25;3-1(4)2(5)6/h1-6,11-12H,7-10,13H2;(H,3,4)(H,5,6) |
| InChIKey | MGBFPMJLTVGWCV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|