C23H27FN2O8 — CID 17366596
(3-fluorophenyl)-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid (PubChem CID 17366596) has the molecular formula C23H27FN2O8 and a molecular weight of 478.47 g/mol. Its IUPAC name is (3-fluorophenyl)-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid.
| Compound Name | (3-fluorophenyl)-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 17366596 |
| Molecular Formula | C23H27FN2O8 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (3-fluorophenyl)-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid |
| SMILES | COc1cc(CN2CCN(C(=O)c3cccc(F)c3)CC2)cc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H25FN2O4.C2H2O4/c1-26-18-11-15(12-19(27-2)20(18)28-3)14-23-7-9-24(10-8-23)21(25)16-5-4-6-17(22)13-16;3-1(4)2(5)6/h4-6,11-13H,7-10,14H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | QFKBZLVGLFKAJG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|