About 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene
1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene (PubChem CID 113461248) has the molecular formula C10H7F6N3
and a molecular weight of 283.18 g/mol. Its IUPAC name is 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene |
| PubChem CID | 113461248 |
| Molecular Formula | C10H7F6N3 |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene |
| SMILES | C[C@H](N=[N+]=[N-])c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7F6N3/c1-5(18-19-17)6-2-7(9(11,12)13)4-8(3-6)10(14,15)16/h2-5H,1H3/t5-/m0/s1 |
| InChIKey | NWWSBFWGHFYWHR-YFKPBYRVSA-N |
| XLogP | 5.10 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene?
The IUPAC name of 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene (CID 113461248) is 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene.
What is the SMILES notation for 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene?
The canonical SMILES for 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene is C[C@H](N=[N+]=[N-])c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene?
The InChIKey is NWWSBFWGHFYWHR-YFKPBYRVSA-N. The full InChI is InChI=1S/C10H7F6N3/c1-5(18-19-17)6-2-7(9(11,12)13)4-8(3-6)10(14,15)16/h2-5H,1H3/t5-/m0/s1.
What are the key properties of 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene?
1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene has a molecular weight of 283.18 g/mol, XLogP of 5.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-1-azidoethyl]-3,5-bis(trifluoromethyl)benzene is sourced from PubChem (CID 113461248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).