About 4-(1-azidoethyl)pyridine
4-(1-azidoethyl)pyridine (PubChem CID 18441931) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 4-(1-azidoethyl)pyridine.
Molecular Properties
| Compound Name | 4-(1-azidoethyl)pyridine |
| PubChem CID | 18441931 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 4-(1-azidoethyl)pyridine |
| SMILES | CC(N=[N+]=[N-])c1ccncc1 |
| InChI | InChI=1S/C7H8N4/c1-6(10-11-8)7-2-4-9-5-3-7/h2-6H,1H3 |
| InChIKey | JDVNCEZHAFDXOB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-azidoethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-azidoethyl)pyridine?
The IUPAC name of 4-(1-azidoethyl)pyridine (CID 18441931) is 4-(1-azidoethyl)pyridine.
What is the SMILES notation for 4-(1-azidoethyl)pyridine?
The canonical SMILES for 4-(1-azidoethyl)pyridine is CC(N=[N+]=[N-])c1ccncc1.
What is the InChIKey of 4-(1-azidoethyl)pyridine?
The InChIKey is JDVNCEZHAFDXOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-6(10-11-8)7-2-4-9-5-3-7/h2-6H,1H3.
What are the key properties of 4-(1-azidoethyl)pyridine?
4-(1-azidoethyl)pyridine has a molecular weight of 148.17 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-azidoethyl)pyridine is sourced from PubChem (CID 18441931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).