C24H28N2O6 — CID 11212841
dimethyl (2R,3S)-2-benzamido-3-[(1S)-1-benzamidobutyl]butanedioate (PubChem CID 11212841) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is dimethyl (2R,3S)-2-benzamido-3-[(1S)-1-benzamidobutyl]butanedioate.
| Compound Name | dimethyl (2R,3S)-2-benzamido-3-[(1S)-1-benzamidobutyl]butanedioate |
|---|---|
| PubChem CID | 11212841 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | dimethyl (2R,3S)-2-benzamido-3-[(1S)-1-benzamidobutyl]butanedioate |
| SMILES | CCC[C@H](NC(=O)c1ccccc1)[C@H](C(=O)OC)[C@@H](NC(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C24H28N2O6/c1-4-11-18(25-21(27)16-12-7-5-8-13-16)19(23(29)31-2)20(24(30)32-3)26-22(28)17-14-9-6-10-15-17/h5-10,12-15,18-20H,4,11H2,1-3H3,(H,25,27)(H,26,28)/t18-,19-,20+/m0/s1 |
| InChIKey | HYGIDYRLUOJQDI-SLFFLAALSA-N |
| XLogP | 2.35 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |