C14H18BrNO3 — CID 20624229
methyl 2-[(4-bromo-3-methylbenzoyl)amino]pentanoate (PubChem CID 20624229) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is methyl 2-[(4-bromo-3-methylbenzoyl)amino]pentanoate.
| Compound Name | methyl 2-[(4-bromo-3-methylbenzoyl)amino]pentanoate |
|---|---|
| PubChem CID | 20624229 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | methyl 2-[(4-bromo-3-methylbenzoyl)amino]pentanoate |
| SMILES | CCCC(NC(=O)c1ccc(Br)c(C)c1)C(=O)OC |
| InChI | InChI=1S/C14H18BrNO3/c1-4-5-12(14(18)19-3)16-13(17)10-6-7-11(15)9(2)8-10/h6-8,12H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | ANTZSAGSOYGJKR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |