C11H9ClNO5- — CID 71330930
2-[(4-chlorobenzoyl)amino]-3-methoxy-3-oxopropanoate (PubChem CID 71330930) has the molecular formula C11H9ClNO5- and a molecular weight of 270.65 g/mol. Its IUPAC name is 2-[(4-chlorobenzoyl)amino]-3-methoxy-3-oxopropanoate.
| Compound Name | 2-[(4-chlorobenzoyl)amino]-3-methoxy-3-oxopropanoate |
|---|---|
| PubChem CID | 71330930 |
| Molecular Formula | C11H9ClNO5- |
| Molecular Weight | 270.65 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 2-[(4-chlorobenzoyl)amino]-3-methoxy-3-oxopropanoate |
| SMILES | COC(=O)C(NC(=O)c1ccc(Cl)cc1)C(=O)[O-] |
| InChI | InChI=1S/C11H10ClNO5/c1-18-11(17)8(10(15)16)13-9(14)6-2-4-7(12)5-3-6/h2-5,8H,1H3,(H,13,14)(H,15,16)/p-1 |
| InChIKey | JABIGHANOCPTGR-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.65 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|