C16H18ClNO4 — CID 153288965
methyl 2-[(4-chlorobenzoyl)amino]-2-(3-hydroxy-6-bicyclo[3.1.0]hexanyl)acetate (PubChem CID 153288965) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is methyl 2-[(4-chlorobenzoyl)amino]-2-(3-hydroxy-6-bicyclo[3.1.0]hexanyl)acetate.
| Compound Name | methyl 2-[(4-chlorobenzoyl)amino]-2-(3-hydroxy-6-bicyclo[3.1.0]hexanyl)acetate |
|---|---|
| PubChem CID | 153288965 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | methyl 2-[(4-chlorobenzoyl)amino]-2-(3-hydroxy-6-bicyclo[3.1.0]hexanyl)acetate |
| SMILES | COC(=O)C(NC(=O)c1ccc(Cl)cc1)C1C2CC(O)CC21 |
| InChI | InChI=1S/C16H18ClNO4/c1-22-16(21)14(13-11-6-10(19)7-12(11)13)18-15(20)8-2-4-9(17)5-3-8/h2-5,10-14,19H,6-7H2,1H3,(H,18,20) |
| InChIKey | QITSWKCBGHUDJG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |