C12H13IN2O4 — CID 71268189
methyl 2-[(4-iodobenzoyl)amino]-3-(methylamino)-3-oxopropanoate (PubChem CID 71268189) has the molecular formula C12H13IN2O4 and a molecular weight of 376.15 g/mol. Its IUPAC name is methyl 2-[(4-iodobenzoyl)amino]-3-(methylamino)-3-oxopropanoate.
| Compound Name | methyl 2-[(4-iodobenzoyl)amino]-3-(methylamino)-3-oxopropanoate |
|---|---|
| PubChem CID | 71268189 |
| Molecular Formula | C12H13IN2O4 |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | methyl 2-[(4-iodobenzoyl)amino]-3-(methylamino)-3-oxopropanoate |
| SMILES | CNC(=O)C(NC(=O)c1ccc(I)cc1)C(=O)OC |
| InChI | InChI=1S/C12H13IN2O4/c1-14-11(17)9(12(18)19-2)15-10(16)7-3-5-8(13)6-4-7/h3-6,9H,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | BEAHHXLKAUAGCJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|