C25H28I2N4O8 — CID 160784375
methyl 2-[(4-iodobenzoyl)amino]-3-(methylamino)-3-oxopropanoate;methyl 2-[(4-iodobenzoyl)amino]-2-methyl-3-(methylamino)-3-oxopropanoate (PubChem CID 160784375) has the molecular formula C25H28I2N4O8 and a molecular weight of 766.33 g/mol. Its IUPAC name is methyl 2-[(4-iodobenzoyl)amino]-3-(methylamino)-3-oxopropanoate;methyl 2-[(4-iodobenzoyl)amino]-2-methyl-3-(methylamino)-3-oxopropanoate.
| Compound Name | methyl 2-[(4-iodobenzoyl)amino]-3-(methylamino)-3-oxopropanoate;methyl 2-[(4-iodobenzoyl)amino]-2-methyl-3-(methylamino)-3-oxopropanoate |
|---|---|
| PubChem CID | 160784375 |
| Molecular Formula | C25H28I2N4O8 |
| Molecular Weight | 766.33 g/mol |
| Exact Mass | 766.00 |
| IUPAC Name | methyl 2-[(4-iodobenzoyl)amino]-3-(methylamino)-3-oxopropanoate;methyl 2-[(4-iodobenzoyl)amino]-2-methyl-3-(methylamino)-3-oxopropanoate |
| SMILES | CNC(=O)C(C)(NC(=O)c1ccc(I)cc1)C(=O)OC.CNC(=O)C(NC(=O)c1ccc(I)cc1)C(=O)OC |
| InChI | InChI=1S/C13H15IN2O4.C12H13IN2O4/c1-13(11(18)15-2,12(19)20-3)16-10(17)8-4-6-9(14)7-5-8;1-14-11(17)9(12(18)19-2)15-10(16)7-3-5-8(13)6-4-7/h4-7H,1-3H3,(H,15,18)(H,16,17);3-6,9H,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | SAZXJXCVEDTFCB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|