C13H16ClNO3 — CID 22761225
4-chloro-N-(1-hydroxy-3,3-dimethyl-2-oxobutyl)benzamide (PubChem CID 22761225) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is 4-chloro-N-(1-hydroxy-3,3-dimethyl-2-oxobutyl)benzamide.
| Compound Name | 4-chloro-N-(1-hydroxy-3,3-dimethyl-2-oxobutyl)benzamide |
|---|---|
| PubChem CID | 22761225 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-chloro-N-(1-hydroxy-3,3-dimethyl-2-oxobutyl)benzamide |
| SMILES | CC(C)(C)C(=O)C(O)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClNO3/c1-13(2,3)10(16)12(18)15-11(17)8-4-6-9(14)7-5-8/h4-7,12,18H,1-3H3,(H,15,17) |
| InChIKey | ZVQSDSQJEPWARO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|