C18H13Cl6F6N2O3P — CID 160762926
4-chloro-N-(1-chloro-2,2,2-trifluoroethyl)benzamide;4-chloro-N-(2,2,2-trifluoro-1-hydroxyethyl)benzamide;trichlorophosphane (PubChem CID 160762926) has the molecular formula C18H13Cl6F6N2O3P and a molecular weight of 662.99 g/mol. Its IUPAC name is 4-chloro-N-(1-chloro-2,2,2-trifluoroethyl)benzamide;4-chloro-N-(2,2,2-trifluoro-1-hydroxyethyl)benzamide;trichlorophosphane.
| Compound Name | 4-chloro-N-(1-chloro-2,2,2-trifluoroethyl)benzamide;4-chloro-N-(2,2,2-trifluoro-1-hydroxyethyl)benzamide;trichlorophosphane |
|---|---|
| PubChem CID | 160762926 |
| Molecular Formula | C18H13Cl6F6N2O3P |
| Molecular Weight | 662.99 g/mol |
| Exact Mass | 659.87 |
| IUPAC Name | 4-chloro-N-(1-chloro-2,2,2-trifluoroethyl)benzamide;4-chloro-N-(2,2,2-trifluoro-1-hydroxyethyl)benzamide;trichlorophosphane |
| SMILES | ClP(Cl)Cl.O=C(NC(Cl)C(F)(F)F)c1ccc(Cl)cc1.O=C(NC(O)C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H6Cl2F3NO.C9H7ClF3NO2.Cl3P/c10-6-3-1-5(2-4-6)7(16)15-8(11)9(12,13)14;10-6-3-1-5(2-4-6)7(15)14-8(16)9(11,12)13;1-4(2)3/h1-4,8H,(H,15,16);1-4,8,16H,(H,14,15); |
| InChIKey | RYHQEOFWQIENLN-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.99 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|