C22H16Cl6N4O2S2 — CID 99670539
N-[(1R)-1-[2-[(1S)-1-benzamido-2,2,2-trichloroethyl]sulfanylpyrimidin-4-yl]sulfanyl-2,2,2-trichloroethyl]benzamide (PubChem CID 99670539) has the molecular formula C22H16Cl6N4O2S2 and a molecular weight of 645.25 g/mol. Its IUPAC name is N-[(1R)-1-[2-[(1S)-1-benzamido-2,2,2-trichloroethyl]sulfanylpyrimidin-4-yl]sulfanyl-2,2,2-trichloroethyl]benzamide.
| Compound Name | N-[(1R)-1-[2-[(1S)-1-benzamido-2,2,2-trichloroethyl]sulfanylpyrimidin-4-yl]sulfanyl-2,2,2-trichloroethyl]benzamide |
|---|---|
| PubChem CID | 99670539 |
| Molecular Formula | C22H16Cl6N4O2S2 |
| Molecular Weight | 645.25 g/mol |
| Exact Mass | 641.88 |
| IUPAC Name | N-[(1R)-1-[2-[(1S)-1-benzamido-2,2,2-trichloroethyl]sulfanylpyrimidin-4-yl]sulfanyl-2,2,2-trichloroethyl]benzamide |
| SMILES | O=C(N[C@H](Sc1ccnc(S[C@H](NC(=O)c2ccccc2)C(Cl)(Cl)Cl)n1)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C22H16Cl6N4O2S2/c23-21(24,25)18(31-16(33)13-7-3-1-4-8-13)35-15-11-12-29-20(30-15)36-19(22(26,27)28)32-17(34)14-9-5-2-6-10-14/h1-12,18-19H,(H,31,33)(H,32,34)/t18-,19+/m1/s1 |
| InChIKey | UTBCSABVIOUSNQ-MOPGFXCFSA-N |
| XLogP | 6.91 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.25 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|