C14H12Cl3N3O2 — CID 171977781
N-[1,1,1-trichloro-3-(6-oxo-1H-pyrimidin-2-yl)propan-2-yl]benzamide (PubChem CID 171977781) has the molecular formula C14H12Cl3N3O2 and a molecular weight of 360.63 g/mol. Its IUPAC name is N-[1,1,1-trichloro-3-(6-oxo-1H-pyrimidin-2-yl)propan-2-yl]benzamide.
| Compound Name | N-[1,1,1-trichloro-3-(6-oxo-1H-pyrimidin-2-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 171977781 |
| Molecular Formula | C14H12Cl3N3O2 |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | N-[1,1,1-trichloro-3-(6-oxo-1H-pyrimidin-2-yl)propan-2-yl]benzamide |
| SMILES | O=C(NC(Cc1nccc(=O)[nH]1)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C14H12Cl3N3O2/c15-14(16,17)10(8-11-18-7-6-12(21)20-11)19-13(22)9-4-2-1-3-5-9/h1-7,10H,8H2,(H,19,22)(H,18,20,21) |
| InChIKey | BBBXIJUTWWFDKL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|