C13H10Cl3N3OS — CID 2830410
N-(2,2,2-trichloro-1-pyrimidin-4-ylsulfanylethyl)benzamide (PubChem CID 2830410) has the molecular formula C13H10Cl3N3OS and a molecular weight of 362.67 g/mol. Its IUPAC name is N-(2,2,2-trichloro-1-pyrimidin-4-ylsulfanylethyl)benzamide.
| Compound Name | N-(2,2,2-trichloro-1-pyrimidin-4-ylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 2830410 |
| Molecular Formula | C13H10Cl3N3OS |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | N-(2,2,2-trichloro-1-pyrimidin-4-ylsulfanylethyl)benzamide |
| SMILES | O=C(NC(Sc1ccncn1)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C13H10Cl3N3OS/c14-13(15,16)12(21-10-6-7-17-8-18-10)19-11(20)9-4-2-1-3-5-9/h1-8,12H,(H,19,20) |
| InChIKey | WGIVTZHCAHRVCC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|