C11H9Cl3N4O — CID 2332953
N-[(1R)-2,2,2-trichloro-1-(1,2,4-triazol-1-yl)ethyl]benzamide (PubChem CID 2332953) has the molecular formula C11H9Cl3N4O and a molecular weight of 319.58 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-(1,2,4-triazol-1-yl)ethyl]benzamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-(1,2,4-triazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 2332953 |
| Molecular Formula | C11H9Cl3N4O |
| Molecular Weight | 319.58 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-(1,2,4-triazol-1-yl)ethyl]benzamide |
| SMILES | O=C(N[C@H](n1cncn1)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C11H9Cl3N4O/c12-11(13,14)10(18-7-15-6-16-18)17-9(19)8-4-2-1-3-5-8/h1-7,10H,(H,17,19)/t10-/m1/s1 |
| InChIKey | SRIUGCBXZFTZFB-SNVBAGLBSA-N |
| XLogP | 2.58 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|