C13H13Cl3N4O2 — CID 70619766
N-[1,2,2-trichloro-3-phenoxy-3-(1,2,4-triazol-1-yl)propyl]acetamide (PubChem CID 70619766) has the molecular formula C13H13Cl3N4O2 and a molecular weight of 363.63 g/mol. Its IUPAC name is N-[1,2,2-trichloro-3-phenoxy-3-(1,2,4-triazol-1-yl)propyl]acetamide.
| Compound Name | N-[1,2,2-trichloro-3-phenoxy-3-(1,2,4-triazol-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 70619766 |
| Molecular Formula | C13H13Cl3N4O2 |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | N-[1,2,2-trichloro-3-phenoxy-3-(1,2,4-triazol-1-yl)propyl]acetamide |
| SMILES | CC(=O)NC(Cl)C(Cl)(Cl)C(Oc1ccccc1)n1cncn1 |
| InChI | InChI=1S/C13H13Cl3N4O2/c1-9(21)19-11(14)13(15,16)12(20-8-17-7-18-20)22-10-5-3-2-4-6-10/h2-8,11-12H,1H3,(H,19,21) |
| InChIKey | KMFABOWTIZBJEZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|