C10H8ClN3O3 — CID 150740809
2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid (PubChem CID 150740809) has the molecular formula C10H8ClN3O3 and a molecular weight of 253.65 g/mol. Its IUPAC name is 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid.
| Compound Name | 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid |
|---|---|
| PubChem CID | 150740809 |
| Molecular Formula | C10H8ClN3O3 |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid |
| SMILES | O=C(O)C(Cl)(Oc1ccccc1)n1cncn1 |
| InChI | InChI=1S/C10H8ClN3O3/c11-10(9(15)16,14-7-12-6-13-14)17-8-4-2-1-3-5-8/h1-7H,(H,15,16) |
| InChIKey | JTUQFEKJTVOXAA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|