About 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid
2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid (PubChem CID 150740809) has the molecular formula C10H8ClN3O3
and a molecular weight of 253.65 g/mol. Its IUPAC name is 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid |
| PubChem CID | 150740809 |
| Molecular Formula | C10H8ClN3O3 |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid |
| SMILES | O=C(O)C(Cl)(Oc1ccccc1)n1cncn1 |
| InChI | InChI=1S/C10H8ClN3O3/c11-10(9(15)16,14-7-12-6-13-14)17-8-4-2-1-3-5-8/h1-7H,(H,15,16) |
| InChIKey | JTUQFEKJTVOXAA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid?
The IUPAC name of 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid (CID 150740809) is 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid.
What is the SMILES notation for 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid?
The canonical SMILES for 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid is O=C(O)C(Cl)(Oc1ccccc1)n1cncn1.
What is the InChIKey of 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid?
The InChIKey is JTUQFEKJTVOXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClN3O3/c11-10(9(15)16,14-7-12-6-13-14)17-8-4-2-1-3-5-8/h1-7H,(H,15,16).
What are the key properties of 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid?
2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid has a molecular weight of 253.65 g/mol, XLogP of 1.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2-phenoxy-2-(1,2,4-triazol-1-yl)acetic acid is sourced from PubChem (CID 150740809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).