C22H22ClN3O5 — CID 56980573
[4-(4-chlorophenoxy)-4-hydroxy-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] 2-phenylacetate (PubChem CID 56980573) has the molecular formula C22H22ClN3O5 and a molecular weight of 443.89 g/mol. Its IUPAC name is [4-(4-chlorophenoxy)-4-hydroxy-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] 2-phenylacetate.
| Compound Name | [4-(4-chlorophenoxy)-4-hydroxy-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] 2-phenylacetate |
|---|---|
| PubChem CID | 56980573 |
| Molecular Formula | C22H22ClN3O5 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | [4-(4-chlorophenoxy)-4-hydroxy-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] 2-phenylacetate |
| SMILES | CC(C)(COC(=O)Cc1ccccc1)C(=O)C(O)(Oc1ccc(Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C22H22ClN3O5/c1-21(2,13-30-19(27)12-16-6-4-3-5-7-16)20(28)22(29,26-15-24-14-25-26)31-18-10-8-17(23)9-11-18/h3-11,14-15,29H,12-13H2,1-2H3 |
| InChIKey | RRHJJOODTCHXNN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|