C20H26ClN3O5 — CID 57249772
[4-(4-chlorophenoxy)-4-hydroxy-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] hexanoate (PubChem CID 57249772) has the molecular formula C20H26ClN3O5 and a molecular weight of 423.90 g/mol. Its IUPAC name is [4-(4-chlorophenoxy)-4-hydroxy-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] hexanoate.
| Compound Name | [4-(4-chlorophenoxy)-4-hydroxy-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] hexanoate |
|---|---|
| PubChem CID | 57249772 |
| Molecular Formula | C20H26ClN3O5 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [4-(4-chlorophenoxy)-4-hydroxy-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] hexanoate |
| SMILES | CCCCCC(=O)OCC(C)(C)C(=O)C(O)(Oc1ccc(Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C20H26ClN3O5/c1-4-5-6-7-17(25)28-12-19(2,3)18(26)20(27,24-14-22-13-23-24)29-16-10-8-15(21)9-11-16/h8-11,13-14,27H,4-7,12H2,1-3H3 |
| InChIKey | FUFVLRWXGWJFSV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|