C24H34ClN3O5 — CID 57268926
[4-(4-chlorophenoxy)-4-hydroxy-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] decanoate (PubChem CID 57268926) has the molecular formula C24H34ClN3O5 and a molecular weight of 480.01 g/mol. Its IUPAC name is [4-(4-chlorophenoxy)-4-hydroxy-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] decanoate.
| Compound Name | [4-(4-chlorophenoxy)-4-hydroxy-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] decanoate |
|---|---|
| PubChem CID | 57268926 |
| Molecular Formula | C24H34ClN3O5 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | [4-(4-chlorophenoxy)-4-hydroxy-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(C)(C)C(=O)C(O)(Oc1ccc(Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C24H34ClN3O5/c1-4-5-6-7-8-9-10-11-21(29)32-16-23(2,3)22(30)24(31,28-18-26-17-27-28)33-20-14-12-19(25)13-15-20/h12-15,17-18,31H,4-11,16H2,1-3H3 |
| InChIKey | ZSXGFMWAVINSLT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|