About [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate
[2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate (PubChem CID 91568309) has the molecular formula C14H18ClNO3
and a molecular weight of 283.75 g/mol. Its IUPAC name is [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate.
Molecular Properties
| Compound Name | [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate |
| PubChem CID | 91568309 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate |
| SMILES | CC(C)(COC(=O)Cc1ccccc1)NC(=O)CCl |
| InChI | InChI=1S/C14H18ClNO3/c1-14(2,16-12(17)9-15)10-19-13(18)8-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3,(H,16,17) |
| InChIKey | LSHVRGMYQHTNFZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate?
The IUPAC name of [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate (CID 91568309) is [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate.
What is the SMILES notation for [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate?
The canonical SMILES for [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate is CC(C)(COC(=O)Cc1ccccc1)NC(=O)CCl.
What is the InChIKey of [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate?
The InChIKey is LSHVRGMYQHTNFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO3/c1-14(2,16-12(17)9-15)10-19-13(18)8-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3,(H,16,17).
What are the key properties of [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate?
[2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate has a molecular weight of 283.75 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-chloroacetyl)amino]-2-methylpropyl] 2-phenylacetate is sourced from PubChem (CID 91568309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).