C33H39Cl2N5O9 — CID 57055198
[5-acetyloxy-4,8-bis(4-chlorophenoxy)-3,7,8-trihydroxy-4-imidazol-1-yl-2,2,6,6-tetramethyl-8-(1,2,4-triazol-1-yl)octyl] acetate (PubChem CID 57055198) has the molecular formula C33H39Cl2N5O9 and a molecular weight of 720.61 g/mol. Its IUPAC name is [5-acetyloxy-4,8-bis(4-chlorophenoxy)-3,7,8-trihydroxy-4-imidazol-1-yl-2,2,6,6-tetramethyl-8-(1,2,4-triazol-1-yl)octyl] acetate.
| Compound Name | [5-acetyloxy-4,8-bis(4-chlorophenoxy)-3,7,8-trihydroxy-4-imidazol-1-yl-2,2,6,6-tetramethyl-8-(1,2,4-triazol-1-yl)octyl] acetate |
|---|---|
| PubChem CID | 57055198 |
| Molecular Formula | C33H39Cl2N5O9 |
| Molecular Weight | 720.61 g/mol |
| Exact Mass | 719.21 |
| IUPAC Name | [5-acetyloxy-4,8-bis(4-chlorophenoxy)-3,7,8-trihydroxy-4-imidazol-1-yl-2,2,6,6-tetramethyl-8-(1,2,4-triazol-1-yl)octyl] acetate |
| SMILES | CC(=O)OCC(C)(C)C(O)C(Oc1ccc(Cl)cc1)(C(OC(C)=O)C(C)(C)C(O)C(O)(Oc1ccc(Cl)cc1)n1cncn1)n1ccnc1 |
| InChI | InChI=1S/C33H39Cl2N5O9/c1-21(41)46-17-30(3,4)27(43)32(39-16-15-36-19-39,48-25-11-7-23(34)8-12-25)29(47-22(2)42)31(5,6)28(44)33(45,40-20-37-18-38-40)49-26-13-9-24(35)10-14-26/h7-16,18-20,27-29,43-45H,17H2,1-6H3 |
| InChIKey | KBPNSYMSPYMBJP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|