C25H30N4O6 — CID 70609479
[4-carbamoyloxy-3-(methoxymethyl)-2,2-dimethyl-4-(4-phenylphenoxy)-4-(1,2,4-triazol-1-yl)butyl] acetate (PubChem CID 70609479) has the molecular formula C25H30N4O6 and a molecular weight of 482.54 g/mol. Its IUPAC name is [4-carbamoyloxy-3-(methoxymethyl)-2,2-dimethyl-4-(4-phenylphenoxy)-4-(1,2,4-triazol-1-yl)butyl] acetate.
| Compound Name | [4-carbamoyloxy-3-(methoxymethyl)-2,2-dimethyl-4-(4-phenylphenoxy)-4-(1,2,4-triazol-1-yl)butyl] acetate |
|---|---|
| PubChem CID | 70609479 |
| Molecular Formula | C25H30N4O6 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | [4-carbamoyloxy-3-(methoxymethyl)-2,2-dimethyl-4-(4-phenylphenoxy)-4-(1,2,4-triazol-1-yl)butyl] acetate |
| SMILES | COCC(C(C)(C)COC(C)=O)C(OC(N)=O)(Oc1ccc(-c2ccccc2)cc1)n1cncn1 |
| InChI | InChI=1S/C25H30N4O6/c1-18(30)33-15-24(2,3)22(14-32-4)25(35-23(26)31,29-17-27-16-28-29)34-21-12-10-20(11-13-21)19-8-6-5-7-9-19/h5-13,16-17,22H,14-15H2,1-4H3,(H2,26,31) |
| InChIKey | RPNDNCXBUBHSTI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|