C27H33N3O6 — CID 54260124
[3-[ethoxy(methyl)carbamoyl]oxy-4-imidazol-1-yl-2,2-dimethyl-4-(4-phenylphenoxy)butyl] acetate (PubChem CID 54260124) has the molecular formula C27H33N3O6 and a molecular weight of 495.58 g/mol. Its IUPAC name is [3-[ethoxy(methyl)carbamoyl]oxy-4-imidazol-1-yl-2,2-dimethyl-4-(4-phenylphenoxy)butyl] acetate.
| Compound Name | [3-[ethoxy(methyl)carbamoyl]oxy-4-imidazol-1-yl-2,2-dimethyl-4-(4-phenylphenoxy)butyl] acetate |
|---|---|
| PubChem CID | 54260124 |
| Molecular Formula | C27H33N3O6 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | [3-[ethoxy(methyl)carbamoyl]oxy-4-imidazol-1-yl-2,2-dimethyl-4-(4-phenylphenoxy)butyl] acetate |
| SMILES | CCON(C)C(=O)OC(C(Oc1ccc(-c2ccccc2)cc1)n1ccnc1)C(C)(C)COC(C)=O |
| InChI | InChI=1S/C27H33N3O6/c1-6-34-29(5)26(32)36-24(27(3,4)18-33-20(2)31)25(30-17-16-28-19-30)35-23-14-12-22(13-15-23)21-10-8-7-9-11-21/h7-17,19,24-25H,6,18H2,1-5H3 |
| InChIKey | RCXJILPBDIMOFL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 92.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|