C23H26BrN3O3 — CID 70600206
4-bromo-4-hydroxy-2-[imidazol-1-yl-(4-phenylphenoxy)methyl]-N,3,3-trimethylbutanamide (PubChem CID 70600206) has the molecular formula C23H26BrN3O3 and a molecular weight of 472.38 g/mol. Its IUPAC name is 4-bromo-4-hydroxy-2-[imidazol-1-yl-(4-phenylphenoxy)methyl]-N,3,3-trimethylbutanamide.
| Compound Name | 4-bromo-4-hydroxy-2-[imidazol-1-yl-(4-phenylphenoxy)methyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 70600206 |
| Molecular Formula | C23H26BrN3O3 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 4-bromo-4-hydroxy-2-[imidazol-1-yl-(4-phenylphenoxy)methyl]-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)C(C(Oc1ccc(-c2ccccc2)cc1)n1ccnc1)C(C)(C)C(O)Br |
| InChI | InChI=1S/C23H26BrN3O3/c1-23(2,22(24)29)19(20(28)25-3)21(27-14-13-26-15-27)30-18-11-9-17(10-12-18)16-7-5-4-6-8-16/h4-15,19,21-22,29H,1-3H3,(H,25,28) |
| InChIKey | WUQHAKVSXPYTRZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|