C15H15FN2O4 — CID 20538663
4-(4-fluorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutanoic acid (PubChem CID 20538663) has the molecular formula C15H15FN2O4 and a molecular weight of 306.29 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutanoic acid.
| Compound Name | 4-(4-fluorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutanoic acid |
|---|---|
| PubChem CID | 20538663 |
| Molecular Formula | C15H15FN2O4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-(4-fluorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)C(Oc1ccc(F)cc1)n1ccnc1 |
| InChI | InChI=1S/C15H15FN2O4/c1-15(2,14(20)21)12(19)13(18-8-7-17-9-18)22-11-5-3-10(16)4-6-11/h3-9,13H,1-2H3,(H,20,21) |
| InChIKey | LCWDHNKTFCYTGA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|