C37H34Cl2N4O2 — CID 174936173
1-(4-chlorophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-one;1-[(2-chlorophenyl)-diphenylmethyl]imidazole (PubChem CID 174936173) has the molecular formula C37H34Cl2N4O2 and a molecular weight of 637.61 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-one;1-[(2-chlorophenyl)-diphenylmethyl]imidazole.
| Compound Name | 1-(4-chlorophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-one;1-[(2-chlorophenyl)-diphenylmethyl]imidazole |
|---|---|
| PubChem CID | 174936173 |
| Molecular Formula | C37H34Cl2N4O2 |
| Molecular Weight | 637.61 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | 1-(4-chlorophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-one;1-[(2-chlorophenyl)-diphenylmethyl]imidazole |
| SMILES | CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1.Clc1ccccc1C(c1ccccc1)(c1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C22H17ClN2.C15H17ClN2O2/c23-21-14-8-7-13-20(21)22(25-16-15-24-17-25,18-9-3-1-4-10-18)19-11-5-2-6-12-19;1-15(2,3)13(19)14(18-9-8-17-10-18)20-12-6-4-11(16)5-7-12/h1-17H;4-10,14H,1-3H3 |
| InChIKey | WUSODLNOHBSRBR-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.61 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|